| Identification |
| Name: | 2-(2-Butoxyethoxy)ethyl dihydrogen phosphate, compound with N,N-dimethylcyclohexylamine |
| Synonyms: | 2-(2-butoxyethoxy)ethyl dihydrogen phosphate, compound with N,N-dimethylcyclohexylamine;Ethanol, 2-(2-butoxyethoxy)-, dihydrogen phosphate, compd. with N,N-dimethylcyclohexanamine;Ethanol, 2-(2-buthoxyethoxy)-, dihydrogenphosphae compd with N,N-dimethylcychexanamine |
| CAS: | 94200-24-5 |
| EINECS: | 303-499-6 |
| Molecular Formula: | C16H36NO6P |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H17N.C8H19O6P/c1-9(2)8-6-4-3-5-7-8;1-2-3-4-12-5-6-13-7-8-14-15(9,10)11/h8H,3-7H2,1-2H3;2-8H2,1H3,(H2,9,10,11) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 253°C |
| Boiling Point: | 494.7°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 253°C |
| Safety Data |
| |
 |
