| Identification | |
| Name: | 2B oil |
| Synonyms: | 3-Chloro-p-toluidine (NH2=1); 2-chloro-4-aminotoluene; 4-Amino-2-chlorotoluene; 3-Chloro-p-toluidine; 3-Chloro-4-methylaniline |
| CAS: | 95-74-9 |
| EINECS: | 202-446-3 |
| Molecular Formula: | C7H8ClN |
| Molecular Weight: | 141.6 |
| InChI: | InChI=1/C7H8ClN/c1-5-2-3-6(9)4-7(5)8/h2-4H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2239 |
| Density: | 1.175 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, acid chlorides, acids, acid anhydrides, chloroformates, reducing agents. |
| Refractive index: | 1.583-1.585 |
| Appearance: | yellow to brown liquid |
| Report: |
Reported in EPA TSCA Inventory. NCI Carcinogenogenesis Bioassay (Feed); Results Negative: Mouse, Rat NCITR* ?? National Cancer Institute Carcinogenesis Technical Report Series. (Bethesda, MD 20014) No. NCI-CG-TR-145 ,1978. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Chemical intermediate for the acid dye palatine fast yellow, bird control agent. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
