| Identification | |
| Name: | 2,5-Dimethylphenol |
| Synonyms: | 2,5-Xylenol; XYLENOL(2,5-); 1,2,5-Xylenol; 1,4-Dimethyl-2-hydroxybenzene; 1-Hydroxy-2,5-dimethylbenzene; 2,5-dimethyl-pheno; 3,6-Dimethylphenol; 3,6-Xylenol; 6-Methyl-m-cresol |
| CAS: | 95-87-4 |
| EINECS: | 202-461-5 |
| Molecular Formula: | C8H10O |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C8H10O/c1-6-3-4-7(2)8(9)5-6/h3-5,9H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2261 |
| Density: | 0.971 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5705 (20 C) |
| Solubility: | 1 g/100 mL (60 oC) in water |
| Appearance: | white to cream crystalline powder |
| Packinggroup: | II |
| HS Code: | 29071400 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | slightly brown |
| Usage: | Used in phosphate esters, alkylated xylenols, antioxidants. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
