| Identification |
| Name: | 4-Nitrotoluene |
| Synonyms: | 1-Methyl-4-nitrobenzene; Melting point standard 4-nitrotoluene; Para-Nitrotoluene |
| CAS: | 99-99-0 |
| EINECS: | 202-808-0 |
| Molecular Formula: | C7H7NO2 |
| Molecular Weight: | 137.14 |
| InChI: | InChI=1/C7H7NO2/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3446 |
| Density: | 1.392 |
| Stability: | Stability May be shock sensitive. Incompatible with sulfuric acid, strong bases, reducing agents, strong oxidizing agents. |
| Refractive index: | 1.5382 |
| Solubility: | 0.35 g/L (20 ºC) |
| Appearance: | light yellow crystals |
| Packinggroup: | II |
| HS Code: | 29042000 |
| Storage Temperature: | 0-6°C |
| Usage: | Synthesis of intermediates & explosives. |
| Safety Data |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
| |
 |
