| Identification |
| Name: | 3-Fluoro-4-nitrotoluene |
| Synonyms: | - |
| CAS: | 446-34-4 |
| EINECS: | 207-166-5 |
| Molecular Formula: | C7H6FNO2 |
| Molecular Weight: | 155.13 |
| InChI: | InChI=1/C7H6FNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN2811 |
| Density: | 1,438 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | slightly soluble in water |
| Solubility: | slightly soluble in water |
| Appearance: | White Solid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
