| Identification |
| Name: | sodium hydrogen sulfite - prop-2-enoic acid (1:1:1) |
| Synonyms: | 2-Propenoic acid, telomer with sodium hydrogen sulfite, sodium salt;Acrylic acid sodium salt polymer, sodium sulfonate terminated;2-Propenoic acid, telomer with sodium sulfite (1:1), sodium salt;LS-195616;Polyacrylic acid, sodium bisulfite terminated;2-Propenoic acid, telomer with sodium hydrogen sulfite;2-Propenoic acid, telomer with sodium sulfite (1:1);Acrylic acid sodium hydrogen sulfite telomer sodium salt;159479-98-8;161050-16-4;66019-18-9;68479-09-4;91144-29-5 |
| CAS: | 159479-98-8;161050-16-4;66019-18-9;68479-09-4;91144-29-5 |
| Molecular Formula: | C3H5NaO5S |
| Molecular Weight: | 176.1236 |
| InChI: | InChI=1/C3H4O2.Na.H2O3S/c1-2-3(4)5;;1-4(2)3/h2H,1H2,(H,4,5);;(H2,1,2,3)/q;+1;/p-1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 61.6°C |
| Boiling Point: | 141°C at 760 mmHg |
| Flash Point: | 61.6°C |
| Safety Data |
| |
 |
