| Identification |
| Name: | ethyl 2-methylprop-2-enoate - methyl 2-methylprop-2-enoate (1:1) |
| Synonyms: | Etakril;2-Propenoic acid, 2-methyl-, ethyl ester, polymer with methyl 2-methyl-2-propenoate;25685-29-4;Lucite 147KNL;AC1L4PJI;Ethyl methacrylate - methyl methacrylate copolymer;Ethyl methacrylate, polymer with methyl methacrylate;ethyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate;8063-45-4;87210-20-6 |
| CAS: | 25685-29-4;8063-45-4;90651-52-8 |
| Molecular Formula: | C11H18O4 |
| Molecular Weight: | 214.2582 |
| InChI: | InChI=1/C6H10O2.C5H8O2/c1-4-8-6(7)5(2)3;1-4(2)5(6)7-3/h2,4H2,1,3H3;1H2,2-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 15.6°C |
| Boiling Point: | 120.5°C at 760 mmHg |
| Flash Point: | 15.6°C |
| Safety Data |
| |
 |
