| Identification | |
| Name: | methyl 2-methylprop-2-enoate - prop-2-enenitrile (1:1) |
| Synonyms: | AC1L538R;2-Methyl-2-propenoic acid, methyl ester, polymer with 2-propenenitrile;methyl 2-methylprop-2-enoate; prop-2-enenitrile;2-Propenenitrile, polymer with methyl 2-methyl-2-propenoate;2-Propenoic acid, 2-methyl-, methyl ester, polymer with 2-propenenitrile;206566-23-6;24937-89-1;30396-85-1 |
| CAS: | 119332-15-9;24937-89-1;30396-85-1;8013-92-1 |
| Molecular Formula: | C8H11NO2 |
| Molecular Weight: | 153.1784 |
| InChI: | InChI=1/C5H8O2.C3H3N/c1-4(2)5(6)7-3;1-2-3-4/h1H2,2-3H3;2H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 10°C |
| Boiling Point: | 100.3°C at 760 mmHg |
| Flash Point: | 10°C |
| Safety Data | |
 |
|
