| Identification | |
| Name: | Aminoguanidine Hydrochloride |
| Synonyms: | carbazamidine hydrochloride |
| CAS: | 1937-19-5;16139-18-7 |
| EINECS: | 240-295-5 |
| Molecular Formula: | CH6N4.xClH |
| Molecular Weight: | 110.55 |
| InChI: | InChI=1/CH6N4.ClH/c2-1(3)5-4;/h4H2,(H4,2,3,5);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 111.9°C |
| Boiling Point: | 261.4°C at 760 mmHg |
| Density: | g/cm3 |
| Solubility: | Soluble to 100 mM in Water |
| Appearance: | White to off-white solid. |
| Flash Point: | 111.9°C |
| Safety Data | |
 |
|
