| Identification | |
| Name: | 2-methylprop-2-enoic acid; octadecyl 2-methylprop-2-enoate; prop-2-enenitrile |
| Synonyms: | AC1O5BXF;Stearyl methacrylate, acrylonitrile, methacrylic acid polymer;2-methylprop-2-enoic acid; octadecyl 2-methylprop-2-enoate; prop-2-enenitrile;2-Propenoic acid, 2-methyl-, polymer with octadecyl 2-methyl-2-propenoate and 2-propenenitrile;67953-86-0 |
| CAS: | 67953-86-0 |
| Molecular Formula: | C29H51NO4 |
| Molecular Weight: | 477.71954 |
| InChI: | InChI=1S/C22H42O2.C4H6O2.C3H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3;1-3(2)4(5)6;1-2-3-4/h2,4-20H2,1,3H3;1H2,2H3,(H,5,6);2H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185°C |
| Boiling Point: | 414.3°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 185°C |
| Safety Data | |
 |
|
