| Identification |
| Name: | (2Z)-4-butoxy-4-oxobut-2-enoic acid - ethenylbenzene (1:1) |
| Synonyms: | 2-Butenedioic acid (Z)-, monobutyl ester, polymer with ethenylbenzene;25215-62-7;AC1O5VCE;Butyl maleate, styrene polymer;(Z)-4-butoxy-4-oxobut-2-enoic acid; styrene;2-Butenedioic acid (2Z)-, 1-butyl ester, polymer with ethenylbenzene;2-Butenedioic acid (2Z)-, monobutyl ester, polymer with ethenylbenzene;112772-18-6;25038-90-8 |
| CAS: | 112772-18-6;25038-90-8;25215-62-7 |
| Molecular Formula: | C16H20O4 |
| Molecular Weight: | 276.3276 |
| InChI: | InChI=1/C8H12O4.C8H8/c1-2-3-6-12-8(11)5-4-7(9)10;1-2-8-6-4-3-5-7-8/h4-5H,2-3,6H2,1H3,(H,9,10);2-7H,1H2/b5-4-; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 113.9°C |
| Boiling Point: | 289.1°C at 760 mmHg |
| Flash Point: | 113.9°C |
| Safety Data |
| |
 |
