| Identification |
| Name: | sodium (2Z)-4-butoxy-4-oxobut-2-enoate - ethenyl acetate (1:1) |
| Synonyms: | 2-Butenedioic acid (2Z)-, monobutyl ester, sodium salt, polymer with ethenyl acetate;2-Butenedioic acid (2Z)-, 1-butyl ester, sodium salt (1:1), polymer with ethenyl acetate;2-Butenedioic acid (Z)-, monobutyl ester, sodium salt, polymer with ethenyl acetate;65294-10-2 |
| CAS: | 65294-10-2 |
| Molecular Formula: | C12H17NaO6 |
| Molecular Weight: | 280.2495 |
| InChI: | InChI=1/C8H12O4.C4H6O2.Na/c1-2-3-6-12-8(11)5-4-7(9)10;1-3-6-4(2)5;/h4-5H,2-3,6H2,1H3,(H,9,10);3H,1H2,2H3;/q;;+1/p-1/b5-4-;; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 113.9°C |
| Boiling Point: | 289.1°C at 760 mmHg |
| Flash Point: | 113.9°C |
| Safety Data |
| |
 |
