| Identification |
| Name: | sodium (4-chloro-2-methylphenoxy)acetate - 3,6-dichloro-2-methoxybenzoic acid (1:1:1) |
| Synonyms: | Banlene;Diamet;Kinorexon I;Chwastox D;Diamet D;3,6-Dichloro-2-methoxybenzoic acid mixt. with sodium (4-chloro-2-methylphenoxy)acetate;Benzoic acid, 3,6-dichloro-2-methoxy-, mixt. with sodium (4-chloro-2-methylphenoxy)acetate;Acetic acid, (4-chloro-2-methylphenoxy)-, sodium salt, mixt. with 3,6-dichloro-2-methoxybenzoic acid;8003-31-4 (Parent);LS-36874;37225-58-4;74871-08-2 |
| CAS: | 37225-58-4;74871-08-2;8003-31-4;8065-43-8;8067-83-2 |
| Molecular Formula: | C17H14Cl3NaO6 |
| Molecular Weight: | 443.6382 |
| InChI: | InChI=1/C9H9ClO3.C8H6Cl2O3.Na/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;1-13-7-5(10)3-2-4(9)6(7)8(11)12;/h2-4H,5H2,1H3,(H,11,12);2-3H,1H3,(H,11,12);/q;;+1/p-1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 151.6°C |
| Boiling Point: | 327°C at 760 mmHg |
| Flash Point: | 151.6°C |
| Safety Data |
| |
 |