| Identification | |
| Name: | Dicyclohexylamine |
| Synonyms: | DCHA; Dicyclohexylamine nitrite |
| CAS: | 101-83-7 |
| EINECS: | 202-980-7 |
| Molecular Formula: | C12H23N |
| Molecular Weight: | 181.32 |
| InChI: | InChI=1/C12H23N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-13H,1-10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2565 |
| Density: | 0.912 |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. |
| Refractive index: | 1.4832-1.4852 |
| Solubility: | Slightly soluble |
| Appearance: | clear to yellow liquid |
| Specification: | Colorless liquid Safety Statements:26-36/37/39-45-60-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| Storage Temperature: | Store at RT. |
| Color: | COLORLESS LIQUID |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
