| Identification | |
| Name: | Ethyl caffeate |
| Synonyms: | Cinnamicacid, 3,4-dihydroxy-, ethyl ester (6CI,7CI,8CI);Caffeic acid ethyl ester;Ethyl 3,4-dihydroxycinnamate;Ethyl caffeoate;2-Propenoic acid, 3-(3,4-dihydroxyphenyl)-, ethyl ester;2-propenoic acid, 3-(3,4-dihydroxyphenyl)-, ethyl ester, (2E)-; |
| CAS: | 102-37-4 |
| Molecular Formula: | C11H12O4 |
| Molecular Weight: | 208.21058 |
| InChI: | InChI=1/C11H12O4/c1-2-15-11(14)6-4-8-3-5-9(12)10(13)7-8/h3-7,12-13H,2H2,1H3/b6-4+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.271g/cm3 |
| Refractive index: | 1.612 |
| Specification: |
Ethyl caffeate , with CAS number of 102-37-4, can be called Caffeic acid ethyl ester ; Ethyl 3,4-dihydroxycinnamate ; Ethyl caffeoate ; Cinnamicacid, 3,4-dihydroxy-, ethyl ester (6CI,7CI,8CI) ; 2-propenoic acid, 3-(3,4-dihydroxyphenyl)-, ethyl ester, (2E)- ; 2-Propenoic acid, 3-(3,4-dihydroxyphenyl)-, ethyl ester . |
| Safety Data | |
 |
|
