| Identification | |
| Name: | Ethyl bromopyruvate |
| Synonyms: | Ethylbromopyruvate (Tech); Ethyl 3-bromopyruvate, (Bromopyruvic acid ethyl ester); Bromopyruvic acid ethyl ester; Ethyl 3-bromopyruvate |
| CAS: | 70-23-5 |
| EINECS: | 200-729-6 |
| Molecular Formula: | C5H7BrO3 |
| Molecular Weight: | 195.01 |
| InChI: | InChI=1/C5H7BrO3/c1-2-9-5(8)4(7)3-6/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 326 |
| Melting Point: | 79 - 82 C |
| Density: | 1.55 |
| Refractive index: | 1.4675-1.4765 |
| Appearance: | white to yellowish liquid |
| Specification: |
?Propanoic acid,3-bromo-2-oxo-, ethyl ester , its cas register number is 70-23-5. It also can be called Ethyl 3-bromopyruvate ; Ethyl bromopyruvate ; beta-Bromopyruvic acid ethyl ester .It is a clear yellow to pink-red liquid with strong offensive odor. |
| Packinggroup: | II |
| HS Code: | 29183000 |
| Storage Temperature: | 2-8°C |
| Usage: | Employed in a synthesis of thioxothiazolidines from primary amines and carbon disulfide.1 |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
