| Identification | |
| Name: | Dicesium oxalate |
| Synonyms: | Cesiumoxalate (Cs2(C2O4)) (7CI);Ethanedioic acid, dicesium salt (9CI);Oxalic acid,dicesium salt (8CI); |
| CAS: | 1068-63-9 |
| EINECS: | 213-950-8 |
| Molecular Formula: | C2H2CsO4 |
| Molecular Weight: | 222.94033 |
| InChI: | InChI=1/C2H2O4.2Cs/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2 |
| Molecular Structure: |  |
| Properties | |
| Appearance: | white powder |
| Specification: |
Dicesium oxalate (CAS NO.1068-63-9) is also named as dicesium oxalate ; Dicesium oxalate, 99.9+% ; oxalic acid cesium salt ; Oxalic acid dicesium ; Oxalic acid dicesium salt . Dicesium oxalate (CAS NO.1068-63-9) is white powder. It is stable and incompatible with acids, strong oxidizing agents. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
