| Identification | |
| Name: | isopropyl chloroformate solution |
| Synonyms: | Isopropyl Chloroformate; Carbonochloridic acid 1-methylethyl ester; Isopropyl chlorocarbonate |
| CAS: | 108-23-6 |
| EINECS: | 203-563-2 |
| Molecular Formula: | C4H7ClO2 |
| Molecular Weight: | 122.55 |
| InChI: | InChI=1/C4H7ClO2/c1-3(2)7-4(5)6/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2407/3286 |
| Melting Point: | -81 |
| Flash Point: | 43? |
| Density: | 0.892 (1.0 M in toluene) |
| Stability: | Hydrolyzes readily in the presence of water or moist air. |
| Refractive index: | 1.485 |
| Solubility: | Insoluble |
| Appearance: | Colorless liq. Pungent. |
| Specification: | Clear colorless solution Safety Statements:26-36/37/39-45-62 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label |
| Packinggroup: | I |
| Flash Point: | 43? |
| Storage Temperature: | 2-8°C |
| Color: | COLORLESS LIQ |
| Usage: | Chemical intermediate for free-radical polymerization initiators, organic synthesis. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
