| Identification | |
| Name: | 2-chloroethyl chloroformate |
| Synonyms: | Chloroformic acid 2-chloroethyl ester |
| CAS: | 627-11-2 |
| EINECS: | 210-982-4 |
| Molecular Formula: | C3H4Cl2O2 |
| Molecular Weight: | 142.96866 |
| InChI: | InChI=1S/C3H4Cl2O2/c4-1-2-7-3(5)6/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3277 |
| Melting Point: | -70 C BOLING |
| Flash Point: | 158? |
| Density: | 1.385 |
| Stability: | No data. |
| Refractive index: | 1.446 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | colorless to slightly colored liquid |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | 158? |
| Storage Temperature: | Refrigerator |
| Color: | Colorless liquid |
| Usage: | Intermediate for synthesis of pesticides, perfumes, drugs, polymers, dyes, and other chemicals chloroformates. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
