| Identification |
| Name: | Butyl chloroformate |
| Synonyms: | n-Butyl chloroformate |
| CAS: | 592-34-7 |
| EINECS: | 209-750-5 |
| Molecular Formula: | C5H9ClO2 |
| Molecular Weight: | 136.58 |
| InChI: | InChI=1/C5H9ClO2/c1-2-3-4-8-5(6)7/h2-4H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2743 |
| Density: | 1.074 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.411-1.413 |
| Water Solubility: | DECOMPOSES |
| Solubility: | practically insoluable (Decomposes- Hydrolysis may occur in the presence of water |
| Appearance: | clear liquid |
| Packinggroup: | I |
| HS Code: | 29159020 |
| Sensitive: | Moisture Sensitive |
| Usage: | Used to make other chemicals. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
