| Identification | |
| Name: | 3,5-Dimethylphenol |
| Synonyms: | 3,5-Xylenol; OBPA; MX |
| CAS: | 108-68-9 |
| EINECS: | 203-606-5 |
| Molecular Formula: | C8H10O |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C8H10O/c1-6-3-7(2)5-8(9)4-6/h3-5,9H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2261 |
| Density: | 0.968 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5362 (20 C) |
| Solubility: | 5.3 g/L (25 oC) |
| Appearance: | white to light beige |
| Specification: | WHITE TO LIGHT BEIGE CRYSTALLINE SOLID Safety Statements:26-28-36/37/39-45-28A 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| HS Code: | 29071400 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air & Light Sensitive |
| Color: | Needles from water Needles from petroleum ether White crystals |
| Usage: | Chemical intermediate for p-chloro- and 2,4-dichloro-m-xylenol-biocides. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
