Identification |
Name: | Octanoic acid, methylester |
Synonyms: | Methyl caprylate;Methyl n-octanoate;NSC3710;Pastell M 08;Radia 7984;Uniphat A 20;Witconol 1095;Witconol 2309;Caprylicacid methyl ester; |
CAS: | 111-11-5 |
EINECS: | 203-835-0 |
Molecular Formula: | C9H18O2 |
Molecular Weight: | 158.24 |
InChI: | InChI=1/C9H18O2/c1-3-4-5-6-7-8-9(10)11-2/h3-8H2,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | GEN |
Melting Point: | -30 C |
Density: | 0.878 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.4165-1.4185 |
Water Solubility: | Insoluble |
Solubility: | Insoluble Appearance:Clear liquid Transport Information: GEN Hazard Symbols:UN NO. particular:particular
|
Appearance: | Clear liquid |
Specification: | clear colorless liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
HS Code: | 29159080 |
Storage Temperature: | −20°C |
Color: | COLORLESS, OILY LIQUID |
Usage: | Intermediate for caprylic acid detergents, emulsifiers, wetting agents, stabilizers, plasticizers, resins, lubricants, flavoring. |
Safety Data |
Hazard Symbols |
|
|
|