| Identification | |
| Name: | Octanoic acid |
| Synonyms: | caprylic acid free acid; Octanoic Acid (1.00193); Caprylic acid; Octylic acid; capylic acid |
| CAS: | 124-07-2 |
| EINECS: | 204-677-5 |
| Molecular Formula: | C8H16O2 |
| Molecular Weight: | 144.21 |
| InChI: | InChI=1/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 0.91 |
| Stability: | Stable. Incompatible with bases, reducing agents, oxidizing agents. Flammable. |
| Refractive index: | 1.4268-1.4288 |
| Solubility: | 0.68 g/L (20 oC) |
| Appearance: | Light yellow Characteristic Liquid |
| Packinggroup: | III |
| Color: | SOLIDIFIES TO LEAFY CRYSTALS WHEN COLD Colorless Oily liquid |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
