| Identification | |
| Name: | Ethanedioic acid,ammonium salt (1:2) |
| Synonyms: | Ammoniumoxalate (6CI,7CI);Ethanedioic acid, diammonium salt (9CI);Oxalic acid,diammonium salt (8CI);Diammonium oxalate; |
| CAS: | 1113-38-8 |
| EINECS: | 214-202-3 |
| Molecular Formula: | C2H8N2O4 |
| Molecular Weight: | 124.1 |
| InChI: | InChI=1/C2H2O4.2H3N/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1759/2449 |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | Colorless crystals or granules |
| Specification: |
Ammonium oxalate (1113-38-8) also can be called Oxalic acid diammonium salt ; Diammonium oxalate ; Ethanedioic acid, diammonium salt and Oxalic acid, diammonium salt . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
