| Identification |
| Name: | Ethanedioic acid,chromium(2+) salt (1:1) |
| Synonyms: | Oxalicacid, chromium(2+) salt (1:1) (8CI); Chromium (II) oxalate; Chromous oxalate |
| CAS: | 814-90-4 |
| EINECS: | 212-410-9 |
| Molecular Formula: | C2H2 O4 . Cr |
| Molecular Weight: | 140.0151 |
| InChI: | InChI=1S/C2H2O4.Cr/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Water Solubility: | Slightly soluble in cold water; soluble in hot water and dilute acids. |
| Solubility: | Slightly soluble in cold water; soluble in hot water and dilute acids. |
| Appearance: | yellow, crystalline powder |
| Packinggroup: | III |
| Safety Data |
| |
 |
