| Identification | |
| Name: | Ethanedioic acid,potassium salt (1:2) |
| Synonyms: | Ethanedioicacid, dipotassium salt (9CI);Oxalic acid, dipotassium salt (8CI);Dipotassiumoxalate;Oxa-Gel;Potassium oxalate;Potassium oxalate (K2C2O4); |
| CAS: | 583-52-8 |
| EINECS: | 209-506-8 |
| Molecular Formula: | K2C2O4 |
| Molecular Weight: | 166.2 |
| InChI: | InChI=1/C2H2O4.2K/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Density: | g/cm3 |
| Stability: | Stable at normal handling and storage temperatures. |
| Solubility: |
Appearance:white crystals Transport Information:50kgs Hazard Symbols:6.1 (Packing Group: III) UN NO. |
| Appearance: | white crystals |
| Storage Temperature: | Store in a cool, dry place. Keep containers closed when not in use. Protect product from moisture. Product is sensitive to light. |
| Usage: | Reagent in analytical chemistry, source of oxalic acid, bleaching and cleaning, removing stains from textiles, photography. |
| Safety Data | |
| Hazard Symbols |
6.1
(Packing Group: III)
UN
NO.
|
 |
|
