| Identification | |
| Name: | Undecylenic acid |
| Synonyms: | 10-Undecenoic acid |
| CAS: | 112-38-9 |
| EINECS: | 203-965-8 |
| Molecular Formula: | C11H20O2 |
| Molecular Weight: | 184.28 |
| InChI: | InChI=1/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Density: | 0.912 |
| Refractive index: | 1.447-1.448 |
| Water Solubility: | INSOLUBLE |
| Solubility: | insoluble in water |
| Appearance: | Colorless or light yellow liquid |
| HS Code: | 29161910 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Used in perfumes, flavouring agents and plastics, and as a modifying agent in plasticizers and lubricant additives; weed killer and defoliant. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
