| Identification | |
| Name: | Diclofenac epolamine |
| Synonyms: | 2-((2,6-Dichlorophenyl)amino)benzeneacetic acid, compd. with 1-pyrrolidineethanol (1:1);Diclofenac 1-(2-hydroxyethyl)pyrrolidinium salt;Diclofenac hydroxyethylpyrrolidine;Flector;2-[2-[(2,6-dichlorophenyl)amino]phenyl]acetic acid; 2-pyrrolidin-1-ylethanol;Diclofenac-N-(2-hydroxyethyl) pyrrolidine;N-(2-Hydroxyethyl)pyrrolidinium (2-((2,6-dichlorophenyl)amino)phenyl)acetate;Benzeneacetic acid, 2-((2,6-dichlorophenyl)amino)-, compd. with 1-pyrrolidineethanol (1:1); |
| CAS: | 119623-66-4 |
| Molecular Formula: | C14H11Cl2NO2.C6H13NO |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H11Cl2NO2.C6H13NO/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;8-6-5-7-3-1-2-4-7/h1-7,17H,8H2,(H,18,19);8H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 203°C |
| Boiling Point: | 412°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Diclofenac epolamine , its cas register number is 119623-66-4. It also can be called DIEP ; 2-((2,6-Dichlorophenyl)amino)benzeneacetic acid 1-pyrrolidineethanol . |
| Flash Point: | 203°C |
| Safety Data | |
 |
|
