| Identification | |
| Name: | Diethylene glycol dibenzoate |
| Synonyms: | Benzoflex 2-42;Benzoflex 2-45;Benzoflex S 45;Di-O-benzoyldiethylene glycol;Flexol 2GB;K-Flex DE;MonocizerPB 3;Velsicol 2-45;Diethyleneglycol, dibenzoate (6CI,7CI,8CI);Ethanol, 2,2'-oxybis-, dibenzoate (9CI);2-[2-(Benzoyloxy)ethoxy]ethyl benzoate; |
| CAS: | 120-55-8 |
| EINECS: | 204-407-6 |
| Molecular Formula: | C18H18O5 |
| Molecular Weight: | 314.34 |
| InChI: | InChI=1/C18H18O5/c19-17(15-7-3-1-4-8-15)22-13-11-21-12-14-23-18(20)16-9-5-2-6-10-16/h1-10H,11-14H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.175 |
| Stability: | No data. |
| Refractive index: | 1.544 |
| Solubility: | Solubility in water, 0.01% |
| Appearance: | Clear liquid |
| Specification: |
?Diethylene glycol dibenzoate (CAS NO.120-55-8), its Synonyms are Polyethylene glycol 100 dibenzoate ; Polyoxyethylene (2) dibenzoate ; Benzo Flex 2-45 ; Benzoic acid, diester with diethylene glycol ; Benzoyloxyethoxyethyl benzoate ; Dibenzoyldiethyleneglycol ester ; Ethanol, 2,2'-oxybis-, dibenzoate . |
| Report: |
?Diethylene glycol dibenzoate is reported in EPA TSCA Inventory. Glycol ether compounds are on the Community Right-To-Know List. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | LIQUID |
| Usage: | Plasticizer. |
| Safety Data | |
 |
|
