| Identification |
| Name: | Diethylene glycol butylether acetate |
| Synonyms: | 2-(2-butoxyethoxy)-Ethanol acetate; 2-(2-Butoxyethoxy)ethyl acetate; 2-(2-n-Butoxyethoxy)ethyl Acetate; Diethylene Glycol Butyl Ether Acetate; Diethylene glycol monobutyl ether acetate; Diethylene Glycol Mono-n-butyl Ether Acetate; Diglycol Monobutyl Ether Acetate; Butyl Carbitol Acetate; n-Butyl Carbitol Acetate; Diethylene glycol monobutyl ether acetate(DBAC) |
| CAS: | 124-17-4 |
| EINECS: | 204-685-9 |
| Molecular Formula: | C10H20O4 |
| Molecular Weight: | 204.26 |
| InChI: | InChI=1/C10H20O4/c1-3-4-5-12-6-7-13-8-9-14-10(2)11/h3-9H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.98 |
| Stability: | Stable, but may be light sensitive. Combustible. Incompatible with strong oxidizing agents, acids, strong bases. |
| Refractive index: | 1.425-1.427 |
| Water Solubility: | 65 g/L |
| Solubility: | 65 g/L |
| Appearance: | Colorless liquid with a mild odor. |
| Packinggroup: | Z01 |
| HS Code: | 29153990 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Color: | Colorless liquid |
| Usage: | Solvent for lacquers and other coatings, antibiotic extractions, coalescing aid for emulsion paints. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
