| Identification | |
| Name: | 3'-Hydroxyacetophenone |
| Synonyms: | Ethanone, 1-(3-hydroxyphenyl)-;m-Acetylphenol;Ethanone, 1- (3-hydroxyphenyl)-;1-(3-Hydroxyphenyl)ethan-1-one;3-Hydroxy acetophenone;Acetophenone, 3-hydroxy- (8CI);1-(3-hydroxyphenyl)ethanone;m-Hydroxyacetophenone;Acetophenone, 3-hydroxy-; |
| CAS: | 121-71-1 |
| EINECS: | 204-494-0 |
| Molecular Formula: | C8H8O2 |
| Molecular Weight: | 136.15 |
| InChI: | InChI=1/C8H8O2/c1-6(9)7-3-2-4-8(10)5-7/h2-5,10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 296 oC |
| Density: | 1.1 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1,534 |
| Solubility: | Very soluble |
| Appearance: | white crystal powder |
| Specification: |
?? 3-Hydroxy acetophenone (CAS No.121-71-1), it also can be called m-Hydroxyacetophenone ; 3-Acetylphenol ; 1-(3-Hydroxyphenyl)ethanon ; Ethanone, 1- (3-hydroxyphenyl)- ; m-Acetylphenol ; 1-(3-Hydroxyphenyl)Ethan-1-One . It is beige-brown crystalline powder. |
| Flash Point: | 296 oC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
