| Identification | |
| Name: | 4'-Hydroxyacetophenone |
| Synonyms: | Methyl-p-hydroxyphenyl ketone;Phenol, p-acetyl-;USAF KF-15;Methyl p-hydroxyphenyl ketone;p-Oxyacetophenone;Acetophenone, p-hydroxy-;Ethanone, 1- (4-hydroxyphenyl)-;p-Hydroxyphenyl methyl ketone;Ethanone,1-(4-hydroxyphenyl)-;Piceol;Acetophenone, 4-hydroxy- (8CI);p-Hydroxacetophenone;4-Hydroxyacetophenone;4-Acetylphenol;1-(4-Hydroxyphenyl)ethanone;1-(4-Hydroxy-phenyl)-ethanone;4-Hydroksyacetofenol [Polish];p-Acetylphenol;D-Hydroxyacetophehone;Acetophenone, 4-hydroxy-;4'-Hydroxyacetophenone (p-Hydroxyacetophenone);4-Hydroxy acteophenone;p-hydroxyphenethyl alcohol;p-Hydroxy Acetophenone;Para Hydroxy Acetophenone (PHAP);4'-Hydroxyacetophenone (PHAP);4'-hydroxyacetophenone;1-(4-hydroxyphenyl)ethanone;; |
| CAS: | 99-93-4 |
| EINECS: | 202-802-8 |
| Molecular Formula: | C8H8O2 |
| Molecular Weight: | 136.15 |
| InChI: | InChI=1/C8H8O2/c1-6(9)7-2-4-8(10)5-3-7/h2-5,10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.109 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.55773 (109 C) |
| Solubility: | methanol: 0.1 g/mL, clear |
| Appearance: | White Crystal |
| Specification: |
?4'-Hydroxyacetophenone , its CAS NO. is 99-93-4, the synonyms are 1-(4-Hydroxyphenyl)ethanone ; 4-Acetylphenol ; 4-Hydroksyacetofenol ; Acetophenone, 4'-hydroxy- ; Acetophenone, p-hydroxy- ; Methyl p-hydroxyphenyl ketone ; Phenol, p-acetyl- ; Piceol ; p-Acetylphenol ; p-Hydroxyacetophenone ; p-Hydroxyphenyl methyl ketone ; p-Oxyacetophenone . |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29145000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
