| Identification | |
| Name: | 2-Chloro-4-nitroaniline |
| Synonyms: | 2-chloro-4-nitro-anilin; 2-chloro-4-nitro-benzenamin; 2-Chloro-4-nitrobenzenamine; 2-CHLORO-4-NITRO-PHENYLAMINE; 1-AMINO-2-CHLORO-4-NITROBENZENE; 4-NITRO-2-CHLOROANILINE; ORTHO CHLORO PARA NITRO ANILINE; ocpn; OCPNA; O-CHLORO-P-NITRO ANILINE; 4-CHLORO-2-NITROANILINE, 1000MG, NEAT; 2-CHLORO-4-NITROANILINE WET 97%; orthoChloro-p-Nitroaniline; o-chloro-nitroaniline |
| CAS: | 121-87-9 |
| EINECS: | 204-502-2 |
| Molecular Formula: | C6H5ClN2O2 |
| Molecular Weight: | 172.57 |
| InChI: | InChI=1/C6H5ClN2O2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2237 |
| Density: | 1.494 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases, strong acids. |
| Refractive index: | 1.646 |
| Solubility: | SOLVENT SOL |
| Appearance: | yellow amorphous powder |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Yellow needles from water |
| Usage: | Intermediate in manufacture of dyes. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
