| Identification | |
| Name: | 4-Chloro-2-nitroaniline |
| Synonyms: | PCONA; O-Nitro-P-Chloroaniline; 4-Chloro-2-nitrobenzenamine; 2-NITRO-4-CHLOROANILINE; 2-AMINO-5-CHLORONITROBENZENE; 1-AMINO-4-CHLORO-2-NITROBENZENE; c.i. azoic diazo component no. 9; FAST RED 3GL BASE; PARA CHLORO ORTHO NITRO ANILINE; p-Chloro-o-nitroaniline; RED 3G BASE; RED 3GL BASE; 4-chloro-2-nitro-anilin; 4-chloro-2-nitro-benzenamid; 4-chloro-2-nitro-benzenamin; 4-Chloro-2-nitro-phenylamine; Azoene Fast Red 3GL Base |
| CAS: | 89-63-4 |
| EINECS: | 201-925-4 |
| Molecular Formula: | C6H5ClN2O2 |
| Molecular Weight: | 172.57 |
| InChI: | InChI=1/C6H5ClN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2237 |
| Boiling Point: | 308.8°C at 760 mmHg |
| Density: | 1.494g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.646 |
| Water Solubility: | INSOLUBLE |
| Solubility: | Insoluble AUTOIGNITION |
| Appearance: | yellow to orange crystalline powder |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Orange crystals Dark orange-yellow prisms from dil alc |
| Usage: | Dye and pigment intermediate. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
N:Dangerousfortheenvironment
|
 |
|
