| Identification | |
| Name: | Thiodiglycolic acid |
| CAS: | 123-93-3 |
| EINECS: | 204-663-9 |
| Molecular Formula: | C4H6O4S |
| Molecular Weight: | 150.15 |
| InChI: | InChI=1/C4H6O4S/c5-3(6)1-9-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.535 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Gray powder. |
| Specification: | GREYISH CRYSTALLINE POWDER Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Storage Temperature: | −20°C |
| Sensitive: | Stench |
| Color: | Crystals from water A white powder or crystals from ethyl acetate/benzene Colorless crystals |
| Usage: | Detection of copper, lead, mercury, silver. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
