| Identification | |
| Name: | Rizatriptan benzoate |
| Synonyms: | 1H-Indole-3-ethanamine,N,N-dimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)-, monobenzoate (9CI);MK 462;Maxalt;1H-Indole-3-ethanamine,N,N-dimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)-, benzoate (1:1);Rizatriptan Benzoate Intermadiate; |
| CAS: | 145202-66-0 |
| Molecular Formula: | C15H19N5 |
| Molecular Weight: | 391.4662 |
| InChI: | InChI=1S/C15H19N5.C7H6O2/c1-19(2)6-5-13-8-17-15-4-3-12(7-14(13)15)9-20-11-16-10-18-20;8-7(9)6-4-2-1-3-5-6/h3-4,7-8,10-11,17H,5-6,9H2,1-2H3;1-5H,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | 259.1oC |
| Boiling Point: | 504.8oCat760mmHg |
| Density: | 1.21g/cm3 |
| Refractive index: | 1.645 |
| Water Solubility: | Soluble |
| Solubility: | Soluble Appearance:white to off-white crystalline powder Transport Information:HAZARD Hazard Symbols:UN NO. |
| Appearance: | white to off-white crystalline powder |
| Flash Point: | 259.1oC |
| Usage: | A selective serotonin 5-HTID receptor agonist. Structurally derived from tryptamine |
| Safety Data | |
| Hazard Symbols | |
 |
|
