| Identification | |
| Name: | 9-Bromoanthracene |
| Synonyms: | 10-Bromoanthracene;9-Anthracenyl bromide;9-Anthracyl bromide;Anthracene,9-bromo-;NSC 803;9-Bromo anthracene; |
| CAS: | 1564-64-3 |
| EINECS: | 216-359-3 |
| Molecular Formula: | C14H9Br |
| Molecular Weight: | 257.13 |
| InChI: | InChI=1/C14H9Br/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 190.3 ºC |
| Boiling Point: | 389.7 ºC at 760 mmHg |
| Density: | 1.479 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.733 |
| Solubility: | Insoluble |
| Appearance: | white to light yellow crystal powder |
| Specification: |
9-Bromoanthracene (CAS NO.1564-64-3) is also named as NSC 803 ; Anthracene, 9-bromo- ; 10-Bromoanthracene ; 9-Anthracenyl bromide ; 9-Bromo anthracene . 9-Bromoanthracene (CAS NO.1564-64-3) is white to light yellow crystal powder. |
| Flash Point: | 190.3 ºC |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
