| Identification | |
| Name: | L-Aspartic acid, sodiumsalt (1:?) |
| Synonyms: | Asparticacid, sodium salt, L- (8CI); L-Aspartic acid, sodium salt (9CI); SodiumL-aspartate |
| CAS: | 17090-93-6 |
| EINECS: | 241-155-6 |
| Molecular Formula: | C4H7 N O4 . x Na |
| Molecular Weight: | 293.96 |
| InChI: | InChI=1/C4H7NO4.Na/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/q;+1/p-1/t2-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 270-271 deg C |
| Flash Point: | 113.5°C |
| Boiling Point: | 264.1°C at 760 mmHg |
| Solubility: | 1 g in 222.2 ml water at 20 deg C; 1 g in 149.9 ml water at 30 deg C; more sol in salt soln; sol in acids, alkalies Insoluble in ethanol, ethyl ether, benzene; soluble in dilute HCl, pyridine In water, 5,360 mg/L at 25 deg C |
| Specification: |
The extinguishing agent of Sodium l-aspartate (CAS No.17090-93-6) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 113.5°C |
| Color: | White, crystalline solid Orthorhombic bisphenoidal leaflets or rods |
| Safety Data | |
 |
|
