| Identification | |
| Name: | L-Aspartic acid, sodiumsalt (1:2) |
| Synonyms: | Asparticacid, disodium salt, L- (8CI);L-Aspartic acid, disodium salt (9CI);DisodiumL-aspartate;Disodium aspartate;Sodium L-aspartate;Sodium aspartate; |
| CAS: | 5598-53-8 |
| EINECS: | 227-012-0 |
| Molecular Formula: | C4H5NNa2O4 |
| Molecular Weight: | 177.08 |
| InChI: | InChI=1/C4H7NO4.2Na/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;/q;2*+1/p-2/t2-;;/m0../s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 270-271 deg C |
| Flash Point: | 113.5°C |
| Boiling Point: | 264.1°Cat760mmHg |
| Density: | 1.514g/cm3 |
| Solubility: | 1 g in 222.2 ml water at 20 deg C; 1 g in 149.9 ml water at 30 deg C; more sol in salt soln; sol in acids, alkalies Insoluble in ethanol, ethyl ether, benzene; soluble in dilute HCl, pyridine In water, 5,360 mg/L at 25 deg C |
| Specification: |
Sodium aspartate (CAS NO.5598-53-8) is found in animals and plants, especially in sugar cane and sugar beets. It may be a neurotransmitter. |
| Flash Point: | 113.5°C |
| Color: | White, crystalline solid Orthorhombic bisphenoidal leaflets or rods |
| Safety Data | |
 |
|
