| Identification | |
| Name: | L-Glutamic acid, sodiumsalt (1:1) |
| Synonyms: | Glutamicacid, monosodium salt, L- (8CI);L-Glutamic acid, monosodium salt (9CI);E 621;Glutacyl;Glutamic acid monosodium salt;L-Glutamic acid sodium salt;Monosodium L-glutamate;Sodium L-glutamate;Sodium hydrogen glutamate;Vetsin;Zest; |
| CAS: | 142-47-2 |
| EINECS: | 205-538-1 |
| Molecular Formula: | C5H8NNaO4 |
| Molecular Weight: | 169.11 |
| InChI: | InChI=1/C5H9NO4.Na/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Stability: | Stable. |
| Refractive index: | 25 ° (C=10, 2mol/L HCl) |
| Solubility: | >=10 g/100 mL at 20 ºC |
| Appearance: | White crystalline powder. |
| Specification: |
Trade names of monosodium glutamate include Ajinomoto, Vetsin, and Accent. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Storage Temperature: | Keep tightly closed in a cool place in a tightly closed container. |
| Color: | white to off-white |
| Usage: | Flavor enhancer. |
| Safety Data | |
 |
|
