| Identification | |
| Name: | Carbamic acid,N-nitroso-N-propyl-, ethyl ester |
| Synonyms: | Carbamicacid, nitrosopropyl-, ethyl ester (8CI,9CI); 1-Propyl-1-nitrosourethane;N-Nitroso-N-propylurethane; N-Propyl-N-nitrosourethane; NSC 123131 |
| CAS: | 19935-86-5 |
| Molecular Formula: | C6H12 N2 O3 |
| Molecular Weight: | 160.20 |
| InChI: | InChI=1/C6H12N2O3/c1-3-5-8(7-10)6(9)11-4-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 66.3°C |
| Boiling Point: | 186°Cat760mmHg |
| Density: | 1.11g/cm3 |
| Refractive index: | 1.467 |
| Specification: |
N-Propyl-N-nitrosourethane , its cas register number is 19935-86-5. It also can be called Carbamic acid, nitrosopropyl-, ethyl ester (8CI)(9CI) ; and Carbamic acid, N-nitroso-N-propyl-, ethyl ester . |
| Flash Point: | 66.3°C |
| Safety Data | |
 |
|
