| Identification | |
| Name: | Carbamic acid,N-ethyl-N-nitroso-, ethyl ester |
| Synonyms: | Carbamicacid, ethylnitroso-, ethyl ester (6CI,7CI,8CI,9CI); EthylN-ethylnitrosocarbamate; Ethyl nitrosourethan; Ethyl nitrosourethane;N-Ethyl-N-nitrosourethane; N-Nitroso-N-ethylurethane; NSC 24890;Nitroso-N-ethylurethane |
| CAS: | 614-95-9 |
| Molecular Formula: | C5H10 N2 O3 |
| Molecular Weight: | 146.17 |
| InChI: | InChI=1/C5H10N2O3/c1-3-7(6-9)5(8)10-4-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 52.8°C |
| Boiling Point: | 163.8°C at 760 mmHg |
| Density: | 1.14g/cm3 |
| Refractive index: | 1.465 |
| Specification: |
N-Nitroso-N-ethylurethan (CAS NO.614-95-9) is a nitrated carbamate ester derivative.Carbamates are incompatible with strong acids and bases, and especially incompatible with strong reducing agents such as hydrides.Strongly oxidizing acids, peroxides, and hydroperoxides are incompatible with carbamates.Flammable gaseous hydrogen is produced by the combination of active metals or nitrides with carbamates.Carbamates are chemically similar to, but more reactive than amides. Like amides they form polymers such as polyurethane resins. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 52.8°C |
| Safety Data | |
 |
|
