| Identification | |
| Name: | Carbamic acid,N-butyl-N-nitroso-, ethyl ester |
| Synonyms: | Carbamicacid, butylnitroso-, ethyl ester (7CI,8CI,9CI); N-Butyl-N-nitrosourethane;N-n-Butyl-N-nitrosourethane; NSC 123130 |
| CAS: | 6558-78-7 |
| Molecular Formula: | C7H14 N2 O3 |
| Molecular Weight: | 174.23 |
| InChI: | InChI=1/C7H14N2O3/c1-3-5-6-9(8-11)7(10)12-4-2/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 79.2°C |
| Boiling Point: | 207.3°C at 760 mmHg |
| Density: | 1.08g/cm3 |
| Refractive index: | 1.468 |
| Specification: |
N-Butyl-N-nitroso ethyl carbamate , its cas register number is 6558-78-7. It also can be called 1-04-00-00372 (Beilstein Handbook Reference) ; 1-Butyl-1-nitrosourethan ; BNUR ; BRN 1780198 ; CCRIS 843 ; Carbamic acid, N-butyl-N-nitroso-, ethyl ester ; Ethyl N-butyl-N-nitrosocarbamate ; Ethylester kyseliny N-butyl-N-nitrosokarbaminove ; N-Butyl-N-nitrosocarbamate ethyl ester ; N-Butyl-N-nitrosourethan ; N-Nitrosobutylurethane ; N-n-Butyl-N-nitrosourethane ; NSC 123130 ; TL 478 . When heated to decomposition it emits toxic fumes of NOx. The storage environment of N-Butyl-N-nitroso ethyl carbamate (CAS NO.6558-78-7) should be ventilate, low-temperature and dry. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 79.2°C |
| Safety Data | |
 |
|
