Identification |
Name: | carbonothioic acid, S-[[(3-chlorophenyl)amino]thioxomethyl] O-ethyl ester |
Synonyms: | Carbonic acid, thio-, anhydrosulfide with m-chlorodithiocarbanilic acid, ethyl ester;Thiocarbonic acid anhydrosulfide with m-chlorodithiocarbanilic acid ethyl ester;AC1MHUNQ;LS-52108;ethyl (3-chlorophenyl)carbamothioylsulfanylformate;20976-09-4 |
CAS: | 20976-09-4 |
Molecular Formula: | C10H10ClNO2S2 |
Molecular Weight: | 275.7749 |
InChI: | InChI=1/C10H10ClNO2S2/c1-2-14-10(13)16-9(15)12-8-5-3-4-7(11)6-8/h3-6H,2H2,1H3,(H,12,15) |
Molecular Structure: |
|
Properties |
Flash Point: | 175.1°C |
Boiling Point: | 366°C at 760 mmHg |
Density: | 1.43g/cm3 |
Refractive index: | 1.666 |
Flash Point: | 175.1°C |
Safety Data |
|
|