| Identification |
| Name: | carbonothioic acid, S-[[(4-bromophenyl)amino]thioxomethyl] O-ethyl ester |
| Synonyms: | Carbonic acid, thio-, anhydrosulfide with p-bromodithiocarbanilic acid, ethyl ester;Thiocarbonic acid anhydrosulfide with p-bromodithiocarbanilic acid ethyl ester;AC1MHUNT;LS-52106;ethyl (4-bromophenyl)carbamothioylsulfanylformate;20976-13-0 |
| CAS: | 20976-13-0 |
| Molecular Formula: | C10H10BrNO2S2 |
| Molecular Weight: | 320.2259 |
| InChI: | InChI=1/C10H10BrNO2S2/c1-2-14-10(13)16-9(15)12-8-5-3-7(11)4-6-8/h3-6H,2H2,1H3,(H,12,15) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 185.3°C |
| Boiling Point: | 382.9°C at 760 mmHg |
| Density: | 1.625g/cm3 |
| Refractive index: | 1.68 |
| Flash Point: | 185.3°C |
| Safety Data |
| |
 |
