| Identification |
| Name: | carbonothioic acid, O-ethyl S-[(1-naphthalenylamino)thioxomethyl] ester |
| Synonyms: | Carbonic acid, thio-, anhydrosulfide with dithio-1-naphthalenecarbamic acid, ethyl ester;Thiocarbonic acid anhydrosulfide with dithio-1-naphthalenecarbamic acid ethyl ester;AC1MHUO2;LS-52115;ethyl naphthalen-1-ylcarbamothioylsulfanylformate;20979-23-1 |
| CAS: | 20979-23-1 |
| Molecular Formula: | C14H13NO2S2 |
| Molecular Weight: | 291.3885 |
| InChI: | InChI=1/C14H13NO2S2/c1-2-17-14(16)19-13(18)15-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3,(H,15,18) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 216.7°C |
| Boiling Point: | 434.7°C at 760 mmHg |
| Density: | 1.355g/cm3 |
| Refractive index: | 1.717 |
| Flash Point: | 216.7°C |
| Safety Data |
| |
 |
