| Identification | |
| Name: | 2-Chloro-4-fluoronitrobenzene |
| Synonyms: | 2-Chloro-4-fluoro-1-nitrobenzene;2-chloro-4-fluoro-1-nitro-benzene; |
| CAS: | 2106-50-5 |
| EINECS: | 218-286-2 |
| Molecular Formula: | C6H3ClFNO2 |
| Molecular Weight: | 175.54 |
| InChI: | InChI=1/C6H3ClFNO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.494 g/cm3 |
| Refractive index: | 1.554 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Room temperature. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
