| Identification |
| Name: | 3-CHLORO-4-FLUORONITROBENZENE |
| Synonyms: | Benzene,2-chloro-1-fluoro-4-nitro-; 3-chloro-4-chloronitrobenzene |
| CAS: | 350-30-1 |
| EINECS: | 206-499-3 |
| Molecular Formula: | C6H3ClFNO2 |
| Molecular Weight: | 175.55 |
| InChI: | InChI=1/C6H3ClFNO2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Flash Point: | 70°C |
| Boiling Point: | 227-232°C |
| Density: | 1.3g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.554 |
| Solubility: | Insoluble |
| Appearance: | white to light yellow crystal powder |
| Packinggroup: | III |
| Flash Point: | 70°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
