| Identification | |
| Name: | Benzidine sulphate |
| Synonyms: | Benzidine sulfate;4,4'-Diaminobiphenyl sulphate;4,4'-Diaminodiphenylene sulfate; |
| CAS: | 21136-70-9 |
| EINECS: | 244-236-4 |
| Molecular Formula: | C12H12N2.H2SO4 |
| Molecular Weight: | 282.32 |
| InChI: | InChI=1/C12H12N2.H2O4S/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-5(2,3)4/h1-8H,13-14H2;(H2,1,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 120 deg C |
| Density: | 1.156g/cm3 |
| Solubility: | 1 g dissolves in 2500 ml cold water; 1 g dissolves in 107 ml boiling water; 1 g dissolves in 5 ml boiling alcohol; 1 g dissolves in 50 ml ether In water, 322 mg/l @ 25 deg C |
| Specification: |
The Benzidine sulphate with the cas number 21136-70-9 is also called 4,4'-Diaminodiphenylene sulfate. The systematic name is biphenyl-4,4'-diaminium sulfate. Its EINECS registry number is 244-236-4. The molecular formula is C12H12N2.H2SO4. The properties of the chemical are: (1)ACD/LogP: 1.56; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.5; (4)ACD/LogD (pH 7.4): 1.56; (5)ACD/BCF (pH 5.5): 7.83; (6)ACD/BCF (pH 7.4): 9.06; (7)ACD/KOC (pH 5.5): 145.68; (8)ACD/KOC (pH 7.4): 168.41; (9)#H bond acceptors: 2; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 0 Å2; (13)Enthalpy of Vaporization: 60.43 kJ/mol; (14)Vapour Pressure: 2.5×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Color: | White or slightly-reddish, crystalline powder Grayish-yellow, reddish-gray, or white crystalline powder [Note: Darkens on exposure to air and light]. |
| Safety Data | |
 |
|
