| Identification | |
| Name: | Benzidine |
| Synonyms: | 4,4'-Diaminobiphenyl; 4-(4-aminophenyl)benzenamine; |
| CAS: | 92-87-5 |
| EINECS: | 202-199-1 |
| Molecular Formula: | C12H12N2 |
| Molecular Weight: | 184.24 |
| InChI: | InChI=1/C12H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,13-14H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1885 |
| Flash Point: | 11 °C |
| Density: | 1.25 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.667 |
| Water Solubility: | Sparingly soluble. |
| Solubility: | Sol in chloroform, carbon disulfide, benzene, ether, alcohol. Very soluble in ethanol and acetone; soluble in ether. In water, 79 mg/L at 25 dec C |
| Appearance: | off-white solid |
| Packinggroup: | II |
| Flash Point: | 11 °C |
| Storage Temperature: | 2-8°C |
| Color: | White crystals Colorless or white crystalline solid ... |
| Usage: | Potentially mutagenic compound. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
